C16H18N4OS — CID 139804843
3-methyl-N-piperidin-4-yl-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide (PubChem CID 139804843) has the molecular formula C16H18N4OS and a molecular weight of 314.41 g/mol. Its IUPAC name is 3-methyl-N-piperidin-4-yl-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide.
| Compound Name | 3-methyl-N-piperidin-4-yl-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide |
|---|---|
| PubChem CID | 139804843 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 3-methyl-N-piperidin-4-yl-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide |
| SMILES | Cc1nc2cccc3n2c1C=C(C(=O)NC1CCNCC1)S3 |
| InChI | InChI=1S/C16H18N4OS/c1-10-12-9-13(16(21)19-11-5-7-17-8-6-11)22-15-4-2-3-14(18-10)20(12)15/h2-4,9,11,17H,5-8H2,1H3,(H,19,21) |
| InChIKey | ULXKVUGRHIPQMS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |