C12H9BrN4S2 — CID 139805339
4-bromo-15-methyl-5,7-dithia-13,14,16,17-tetrazatetracyclo[8.7.0.02,6.012,16]heptadeca-1(17),2(6),3,10,12,14-hexaene (PubChem CID 139805339) has the molecular formula C12H9BrN4S2 and a molecular weight of 353.27 g/mol. Its IUPAC name is 4-bromo-15-methyl-5,7-dithia-13,14,16,17-tetrazatetracyclo[8.7.0.02,6.012,16]heptadeca-1(17),2(6),3,10,12,14-hexaene.
| Compound Name | 4-bromo-15-methyl-5,7-dithia-13,14,16,17-tetrazatetracyclo[8.7.0.02,6.012,16]heptadeca-1(17),2(6),3,10,12,14-hexaene |
|---|---|
| PubChem CID | 139805339 |
| Molecular Formula | C12H9BrN4S2 |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 351.95 |
| IUPAC Name | 4-bromo-15-methyl-5,7-dithia-13,14,16,17-tetrazatetracyclo[8.7.0.02,6.012,16]heptadeca-1(17),2(6),3,10,12,14-hexaene |
| SMILES | Cc1nnc2cc3c(nn12)-c1cc(Br)sc1SCC3 |
| InChI | InChI=1S/C12H9BrN4S2/c1-6-14-15-10-4-7-2-3-18-12-8(5-9(13)19-12)11(7)16-17(6)10/h4-5H,2-3H2,1H3 |
| InChIKey | UBZITDBECHCDID-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |