C27H35FO2 — CID 139805794
tert-butyl 7-fluorooctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-15-ene-6-carboxylate (PubChem CID 139805794) has the molecular formula C27H35FO2 and a molecular weight of 410.57 g/mol. Its IUPAC name is tert-butyl 7-fluorooctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-15-ene-6-carboxylate.
| Compound Name | tert-butyl 7-fluorooctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-15-ene-6-carboxylate |
|---|---|
| PubChem CID | 139805794 |
| Molecular Formula | C27H35FO2 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | tert-butyl 7-fluorooctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-15-ene-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1C(F)C2CC1C1C3CC(C21)C1C2CC(C4C5C=CC(C5)C24)C31 |
| InChI | InChI=1S/C27H35FO2/c1-27(2,3)30-26(29)24-16-9-17(25(24)28)23-15-8-14(22(16)23)20-12-7-13(21(15)20)19-11-5-4-10(6-11)18(12)19/h4-5,10-25H,6-9H2,1-3H3 |
| InChIKey | UZNIXZMRNUETPW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|