C19H23NO5 — CID 1398059
dimethyl (2R,3S)-2-(phenylcarbamoyl)bicyclo[2.2.2]octane-1,3-dicarboxylate (PubChem CID 1398059) has the molecular formula C19H23NO5 and a molecular weight of 345.39 g/mol. Its IUPAC name is dimethyl (2R,3S)-2-(phenylcarbamoyl)bicyclo[2.2.2]octane-1,3-dicarboxylate.
| Compound Name | dimethyl (2R,3S)-2-(phenylcarbamoyl)bicyclo[2.2.2]octane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 1398059 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | dimethyl (2R,3S)-2-(phenylcarbamoyl)bicyclo[2.2.2]octane-1,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1C2CCC(C(=O)OC)(CC2)[C@@H]1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H23NO5/c1-24-17(22)14-12-8-10-19(11-9-12,18(23)25-2)15(14)16(21)20-13-6-4-3-5-7-13/h3-7,12,14-15H,8-11H2,1-2H3,(H,20,21)/t12?,14-,15-,19?/m0/s1 |
| InChIKey | AYBLBXOFNYOJJB-CNXDNABOSA-N |
| XLogP | 2.39 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |