C20H34O3Si — CID 139806124
(3E,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(cyclohexylidenemethyl)-3-ethylideneoxan-2-one (PubChem CID 139806124) has the molecular formula C20H34O3Si and a molecular weight of 350.58 g/mol. Its IUPAC name is (3E,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(cyclohexylidenemethyl)-3-ethylideneoxan-2-one.
| Compound Name | (3E,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(cyclohexylidenemethyl)-3-ethylideneoxan-2-one |
|---|---|
| PubChem CID | 139806124 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (3E,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(cyclohexylidenemethyl)-3-ethylideneoxan-2-one |
| SMILES | C/C=C1\C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C=C2CCCCC2)OC1=O |
| InChI | InChI=1S/C20H34O3Si/c1-7-16-14-18(23-24(5,6)20(2,3)4)17(22-19(16)21)13-15-11-9-8-10-12-15/h7,13,17-18H,8-12,14H2,1-6H3/b16-7+/t17-,18+/m1/s1 |
| InChIKey | LGENJLBYLWXTLA-PBWIFMEXSA-N |
| XLogP | 5.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|