About O-heptadecyl pentanethioate
O-heptadecyl pentanethioate (PubChem CID 139806129) has the molecular formula C22H44OS
and a molecular weight of 356.66 g/mol. Its IUPAC name is O-heptadecyl pentanethioate.
Molecular Properties
| Compound Name | O-heptadecyl pentanethioate |
| PubChem CID | 139806129 |
| Molecular Formula | C22H44OS |
| Molecular Weight | 356.66 g/mol |
| Exact Mass | 356.31 |
| IUPAC Name | O-heptadecyl pentanethioate |
| SMILES | CCCCCCCCCCCCCCCCCOC(=S)CCCC |
| InChI | InChI=1S/C22H44OS/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-21-23-22(24)20-6-4-2/h3-21H2,1-2H3 |
| InChIKey | UVRQCLUQXGYOKI-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.66 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-heptadecyl pentanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-heptadecyl pentanethioate?
The IUPAC name of O-heptadecyl pentanethioate (CID 139806129) is O-heptadecyl pentanethioate.
What is the SMILES notation for O-heptadecyl pentanethioate?
The canonical SMILES for O-heptadecyl pentanethioate is CCCCCCCCCCCCCCCCCOC(=S)CCCC.
What is the InChIKey of O-heptadecyl pentanethioate?
The InChIKey is UVRQCLUQXGYOKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44OS/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-21-23-22(24)20-6-4-2/h3-21H2,1-2H3.
What are the key properties of O-heptadecyl pentanethioate?
O-heptadecyl pentanethioate has a molecular weight of 356.66 g/mol, XLogP of 8.39, 19 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-heptadecyl pentanethioate is sourced from PubChem (CID 139806129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).