C19H25NO3 — CID 139806223
1,4-dihydroxy-N-octylnaphthalene-2-carboxamide (PubChem CID 139806223) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 1,4-dihydroxy-N-octylnaphthalene-2-carboxamide.
| Compound Name | 1,4-dihydroxy-N-octylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 139806223 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 1,4-dihydroxy-N-octylnaphthalene-2-carboxamide |
| SMILES | CCCCCCCCNC(=O)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C19H25NO3/c1-2-3-4-5-6-9-12-20-19(23)16-13-17(21)14-10-7-8-11-15(14)18(16)22/h7-8,10-11,13,21-22H,2-6,9,12H2,1H3,(H,20,23) |
| InChIKey | SXYPKOSVOYRULT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|