C9H4F14INO — CID 139806435
2,2,3,3,5,5,6,6-octafluoro-4-(1,1,3,3,5,5-hexafluoro-5-iodopentyl)morpholine (PubChem CID 139806435) has the molecular formula C9H4F14INO and a molecular weight of 535.01 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octafluoro-4-(1,1,3,3,5,5-hexafluoro-5-iodopentyl)morpholine.
| Compound Name | 2,2,3,3,5,5,6,6-octafluoro-4-(1,1,3,3,5,5-hexafluoro-5-iodopentyl)morpholine |
|---|---|
| PubChem CID | 139806435 |
| Molecular Formula | C9H4F14INO |
| Molecular Weight | 535.01 g/mol |
| Exact Mass | 534.91 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octafluoro-4-(1,1,3,3,5,5-hexafluoro-5-iodopentyl)morpholine |
| SMILES | FC(F)(I)CC(F)(F)CC(F)(F)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C9H4F14INO/c10-3(11,1-4(12,13)24)2-5(14,15)25-6(16,17)8(20,21)26-9(22,23)7(25,18)19/h1-2H2 |
| InChIKey | LGDXNFFLENGTIM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.01 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|