About 3,3-bis(4-azidobutyl)-5-(2-methylpropyl)-1,2-dihydroindene
3,3-bis(4-azidobutyl)-5-(2-methylpropyl)-1,2-dihydroindene (PubChem CID 139806498) has the molecular formula C21H32N6
and a molecular weight of 368.53 g/mol. Its IUPAC name is 3,3-bis(4-azidobutyl)-5-(2-methylpropyl)-1,2-dihydroindene.
Molecular Properties
| Compound Name | 3,3-bis(4-azidobutyl)-5-(2-methylpropyl)-1,2-dihydroindene |
| PubChem CID | 139806498 |
| Molecular Formula | C21H32N6 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 3,3-bis(4-azidobutyl)-5-(2-methylpropyl)-1,2-dihydroindene |
| SMILES | CC(C)Cc1ccc2c(c1)C(CCCCN=[N+]=[N-])(CCCCN=[N+]=[N-])CC2 |
| InChI | InChI=1S/C21H32N6/c1-17(2)15-18-7-8-19-9-12-21(20(19)16-18,10-3-5-13-24-26-22)11-4-6-14-25-27-23/h7-8,16-17H,3-6,9-15H2,1-2H3 |
| InChIKey | KGVFAGDQIKMEBS-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3,3-bis(4-azidobutyl)-5-(2-methylpropyl)-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(4-azidobutyl)-5-(2-methylpropyl)-1,2-dihydroindene?
The IUPAC name of 3,3-bis(4-azidobutyl)-5-(2-methylpropyl)-1,2-dihydroindene (CID 139806498) is 3,3-bis(4-azidobutyl)-5-(2-methylpropyl)-1,2-dihydroindene.
What is the SMILES notation for 3,3-bis(4-azidobutyl)-5-(2-methylpropyl)-1,2-dihydroindene?
The canonical SMILES for 3,3-bis(4-azidobutyl)-5-(2-methylpropyl)-1,2-dihydroindene is CC(C)Cc1ccc2c(c1)C(CCCCN=[N+]=[N-])(CCCCN=[N+]=[N-])CC2.
What is the InChIKey of 3,3-bis(4-azidobutyl)-5-(2-methylpropyl)-1,2-dihydroindene?
The InChIKey is KGVFAGDQIKMEBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32N6/c1-17(2)15-18-7-8-19-9-12-21(20(19)16-18,10-3-5-13-24-26-22)11-4-6-14-25-27-23/h7-8,16-17H,3-6,9-15H2,1-2H3.
What are the key properties of 3,3-bis(4-azidobutyl)-5-(2-methylpropyl)-1,2-dihydroindene?
3,3-bis(4-azidobutyl)-5-(2-methylpropyl)-1,2-dihydroindene has a molecular weight of 368.53 g/mol, XLogP of 7.03, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(4-azidobutyl)-5-(2-methylpropyl)-1,2-dihydroindene is sourced from PubChem (CID 139806498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).