C27H33N3O3S — CID 139806946
3-(N-(4-aminophenyl)sulfonylanilino)-N-[2,6-di(propan-2-yl)phenyl]propanamide (PubChem CID 139806946) has the molecular formula C27H33N3O3S and a molecular weight of 479.65 g/mol. Its IUPAC name is 3-(N-(4-aminophenyl)sulfonylanilino)-N-[2,6-di(propan-2-yl)phenyl]propanamide.
| Compound Name | 3-(N-(4-aminophenyl)sulfonylanilino)-N-[2,6-di(propan-2-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 139806946 |
| Molecular Formula | C27H33N3O3S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 3-(N-(4-aminophenyl)sulfonylanilino)-N-[2,6-di(propan-2-yl)phenyl]propanamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CCN(c1ccccc1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C27H33N3O3S/c1-19(2)24-11-8-12-25(20(3)4)27(24)29-26(31)17-18-30(22-9-6-5-7-10-22)34(32,33)23-15-13-21(28)14-16-23/h5-16,19-20H,17-18,28H2,1-4H3,(H,29,31) |
| InChIKey | JWMPEEHQMPUHHZ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|