C23H23NO3 — CID 139807213
1-[4-(cyclohexylmethoxy)phenyl]-2-(1H-indol-3-yl)ethane-1,2-dione (PubChem CID 139807213) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is 1-[4-(cyclohexylmethoxy)phenyl]-2-(1H-indol-3-yl)ethane-1,2-dione.
| Compound Name | 1-[4-(cyclohexylmethoxy)phenyl]-2-(1H-indol-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 139807213 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 1-[4-(cyclohexylmethoxy)phenyl]-2-(1H-indol-3-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)c1c[nH]c2ccccc12)c1ccc(OCC2CCCCC2)cc1 |
| InChI | InChI=1S/C23H23NO3/c25-22(23(26)20-14-24-21-9-5-4-8-19(20)21)17-10-12-18(13-11-17)27-15-16-6-2-1-3-7-16/h4-5,8-14,16,24H,1-3,6-7,15H2 |
| InChIKey | NQNJYVAWJQFGTN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|