C20H22FN5O2S — CID 139810493
10-cyclopropyl-7-fluoro-8-(4-methylpiperazin-1-yl)-2-methylsulfanyl-3H-pyrimido[4,5-b]quinoline-4,5-dione (PubChem CID 139810493) has the molecular formula C20H22FN5O2S and a molecular weight of 415.49 g/mol. Its IUPAC name is 10-cyclopropyl-7-fluoro-8-(4-methylpiperazin-1-yl)-2-methylsulfanyl-3H-pyrimido[4,5-b]quinoline-4,5-dione.
| Compound Name | 10-cyclopropyl-7-fluoro-8-(4-methylpiperazin-1-yl)-2-methylsulfanyl-3H-pyrimido[4,5-b]quinoline-4,5-dione |
|---|---|
| PubChem CID | 139810493 |
| Molecular Formula | C20H22FN5O2S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 10-cyclopropyl-7-fluoro-8-(4-methylpiperazin-1-yl)-2-methylsulfanyl-3H-pyrimido[4,5-b]quinoline-4,5-dione |
| SMILES | CSc1nc2c(c(=O)[nH]1)c(=O)c1cc(F)c(N3CCN(C)CC3)cc1n2C1CC1 |
| InChI | InChI=1S/C20H22FN5O2S/c1-24-5-7-25(8-6-24)15-10-14-12(9-13(15)21)17(27)16-18(26(14)11-3-4-11)22-20(29-2)23-19(16)28/h9-11H,3-8H2,1-2H3,(H,22,23,28) |
| InChIKey | DVUXZBQYNWGOLX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|