About 2-cyclopenta-2,4-dien-1-ylideneoxane
2-cyclopenta-2,4-dien-1-ylideneoxane (PubChem CID 139811351) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is 2-cyclopenta-2,4-dien-1-ylideneoxane.
Molecular Properties
| Compound Name | 2-cyclopenta-2,4-dien-1-ylideneoxane |
| PubChem CID | 139811351 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 2-cyclopenta-2,4-dien-1-ylideneoxane |
| SMILES | C1=CC(=C2CCCCO2)C=C1 |
| InChI | InChI=1S/C10H12O/c1-2-6-9(5-1)10-7-3-4-8-11-10/h1-2,5-6H,3-4,7-8H2 |
| InChIKey | BOLMZROTYOIGAX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopenta-2,4-dien-1-ylideneoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopenta-2,4-dien-1-ylideneoxane?
The IUPAC name of 2-cyclopenta-2,4-dien-1-ylideneoxane (CID 139811351) is 2-cyclopenta-2,4-dien-1-ylideneoxane.
What is the SMILES notation for 2-cyclopenta-2,4-dien-1-ylideneoxane?
The canonical SMILES for 2-cyclopenta-2,4-dien-1-ylideneoxane is C1=CC(=C2CCCCO2)C=C1.
What is the InChIKey of 2-cyclopenta-2,4-dien-1-ylideneoxane?
The InChIKey is BOLMZROTYOIGAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O/c1-2-6-9(5-1)10-7-3-4-8-11-10/h1-2,5-6H,3-4,7-8H2.
What are the key properties of 2-cyclopenta-2,4-dien-1-ylideneoxane?
2-cyclopenta-2,4-dien-1-ylideneoxane has a molecular weight of 148.20 g/mol, XLogP of 2.57, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopenta-2,4-dien-1-ylideneoxane is sourced from PubChem (CID 139811351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).