C21H37N3O — CID 139811529
(3aS,7aR)-3-[3-(4-cyclohexylpiperazin-1-yl)propyl]-1,3,3a,4,5,6,7,7a-octahydroindol-2-one (PubChem CID 139811529) has the molecular formula C21H37N3O and a molecular weight of 347.55 g/mol. Its IUPAC name is (3aS,7aR)-3-[3-(4-cyclohexylpiperazin-1-yl)propyl]-1,3,3a,4,5,6,7,7a-octahydroindol-2-one.
| Compound Name | (3aS,7aR)-3-[3-(4-cyclohexylpiperazin-1-yl)propyl]-1,3,3a,4,5,6,7,7a-octahydroindol-2-one |
|---|---|
| PubChem CID | 139811529 |
| Molecular Formula | C21H37N3O |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.29 |
| IUPAC Name | (3aS,7aR)-3-[3-(4-cyclohexylpiperazin-1-yl)propyl]-1,3,3a,4,5,6,7,7a-octahydroindol-2-one |
| SMILES | O=C1N[C@@H]2CCCC[C@H]2C1CCCN1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C21H37N3O/c25-21-19(18-9-4-5-11-20(18)22-21)10-6-12-23-13-15-24(16-14-23)17-7-2-1-3-8-17/h17-20H,1-16H2,(H,22,25)/t18-,19?,20+/m0/s1 |
| InChIKey | WKYRTGKHENGRRJ-SJBAFXMYSA-N |
| XLogP | 3.02 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |