C9H16N2 — CID 139812379
4-methyl-2,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrimidine (PubChem CID 139812379) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 4-methyl-2,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrimidine.
| Compound Name | 4-methyl-2,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 139812379 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 4-methyl-2,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrimidine |
| SMILES | CC1=CCNC2CCCCN12 |
| InChI | InChI=1S/C9H16N2/c1-8-5-6-10-9-4-2-3-7-11(8)9/h5,9-10H,2-4,6-7H2,1H3 |
| InChIKey | ZTIFNQZVFGOOQB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |