About 4-ethoxycyclohexa-2,4-diene-1,1-dicarboxylic acid
4-ethoxycyclohexa-2,4-diene-1,1-dicarboxylic acid (PubChem CID 139812717) has the molecular formula C10H12O5
and a molecular weight of 212.20 g/mol. Its IUPAC name is 4-ethoxycyclohexa-2,4-diene-1,1-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-ethoxycyclohexa-2,4-diene-1,1-dicarboxylic acid |
| PubChem CID | 139812717 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 4-ethoxycyclohexa-2,4-diene-1,1-dicarboxylic acid |
| SMILES | CCOC1=CCC(C(=O)O)(C(=O)O)C=C1 |
| InChI | InChI=1S/C10H12O5/c1-2-15-7-3-5-10(6-4-7,8(11)12)9(13)14/h3-5H,2,6H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | LNGULJTXBUIZHZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxycyclohexa-2,4-diene-1,1-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxycyclohexa-2,4-diene-1,1-dicarboxylic acid?
The IUPAC name of 4-ethoxycyclohexa-2,4-diene-1,1-dicarboxylic acid (CID 139812717) is 4-ethoxycyclohexa-2,4-diene-1,1-dicarboxylic acid.
What is the SMILES notation for 4-ethoxycyclohexa-2,4-diene-1,1-dicarboxylic acid?
The canonical SMILES for 4-ethoxycyclohexa-2,4-diene-1,1-dicarboxylic acid is CCOC1=CCC(C(=O)O)(C(=O)O)C=C1.
What is the InChIKey of 4-ethoxycyclohexa-2,4-diene-1,1-dicarboxylic acid?
The InChIKey is LNGULJTXBUIZHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O5/c1-2-15-7-3-5-10(6-4-7,8(11)12)9(13)14/h3-5H,2,6H2,1H3,(H,11,12)(H,13,14).
What are the key properties of 4-ethoxycyclohexa-2,4-diene-1,1-dicarboxylic acid?
4-ethoxycyclohexa-2,4-diene-1,1-dicarboxylic acid has a molecular weight of 212.20 g/mol, XLogP of 1.02, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxycyclohexa-2,4-diene-1,1-dicarboxylic acid is sourced from PubChem (CID 139812717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).