C24H24FNO3 — CID 139813680
(2S,3S)-3-(dibenzylamino)-4-(2-fluorophenyl)-2-hydroxybutanoic acid (PubChem CID 139813680) has the molecular formula C24H24FNO3 and a molecular weight of 393.46 g/mol. Its IUPAC name is (2S,3S)-3-(dibenzylamino)-4-(2-fluorophenyl)-2-hydroxybutanoic acid.
| Compound Name | (2S,3S)-3-(dibenzylamino)-4-(2-fluorophenyl)-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 139813680 |
| Molecular Formula | C24H24FNO3 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (2S,3S)-3-(dibenzylamino)-4-(2-fluorophenyl)-2-hydroxybutanoic acid |
| SMILES | O=C(O)[C@@H](O)[C@H](Cc1ccccc1F)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H24FNO3/c25-21-14-8-7-13-20(21)15-22(23(27)24(28)29)26(16-18-9-3-1-4-10-18)17-19-11-5-2-6-12-19/h1-14,22-23,27H,15-17H2,(H,28,29)/t22-,23-/m0/s1 |
| InChIKey | UANZCGWKXYCFPL-GOTSBHOMSA-N |
| XLogP | 3.88 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |