About 4-(dibutylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile
4-(dibutylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile (PubChem CID 139814154) has the molecular formula C16H18F3N3
and a molecular weight of 309.34 g/mol. Its IUPAC name is 4-(dibutylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-(dibutylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile |
| PubChem CID | 139814154 |
| Molecular Formula | C16H18F3N3 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 4-(dibutylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile |
| SMILES | CCCCN(CCCC)c1c(F)c(F)c(C#N)c(C#N)c1F |
| InChI | InChI=1S/C16H18F3N3/c1-3-5-7-22(8-6-4-2)16-14(18)12(10-21)11(9-20)13(17)15(16)19/h3-8H2,1-2H3 |
| InChIKey | VNMLNMNITPYNGJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(dibutylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dibutylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile?
The IUPAC name of 4-(dibutylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile (CID 139814154) is 4-(dibutylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-(dibutylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile?
The canonical SMILES for 4-(dibutylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile is CCCCN(CCCC)c1c(F)c(F)c(C#N)c(C#N)c1F.
What is the InChIKey of 4-(dibutylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile?
The InChIKey is VNMLNMNITPYNGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F3N3/c1-3-5-7-22(8-6-4-2)16-14(18)12(10-21)11(9-20)13(17)15(16)19/h3-8H2,1-2H3.
What are the key properties of 4-(dibutylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile?
4-(dibutylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile has a molecular weight of 309.34 g/mol, XLogP of 4.25, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dibutylamino)-3,5,6-trifluorobenzene-1,2-dicarbonitrile is sourced from PubChem (CID 139814154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).