C20H20O6 — CID 139814361
[(4aS,5R,6S)-5-hydroxy-3,4a,5-trimethyl-2-oxo-6,7-dihydro-4H-benzo[f][1]benzofuran-6-yl] furan-2-carboxylate (PubChem CID 139814361) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is [(4aS,5R,6S)-5-hydroxy-3,4a,5-trimethyl-2-oxo-6,7-dihydro-4H-benzo[f][1]benzofuran-6-yl] furan-2-carboxylate.
| Compound Name | [(4aS,5R,6S)-5-hydroxy-3,4a,5-trimethyl-2-oxo-6,7-dihydro-4H-benzo[f][1]benzofuran-6-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 139814361 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [(4aS,5R,6S)-5-hydroxy-3,4a,5-trimethyl-2-oxo-6,7-dihydro-4H-benzo[f][1]benzofuran-6-yl] furan-2-carboxylate |
| SMILES | CC1=C2C[C@@]3(C)C(=CC[C@H](OC(=O)c4ccco4)[C@]3(C)O)C=C2OC1=O |
| InChI | InChI=1S/C20H20O6/c1-11-13-10-19(2)12(9-15(13)25-17(11)21)6-7-16(20(19,3)23)26-18(22)14-5-4-8-24-14/h4-6,8-9,16,23H,7,10H2,1-3H3/t16-,19-,20-/m0/s1 |
| InChIKey | CAZQBHBWWKZXBQ-VDGAXYAQSA-N |
| XLogP | 3.05 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |