C19H24N2O — CID 139814513
(R)-1,2-dihydroquinolin-4-yl-[(2S,4S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol (PubChem CID 139814513) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is (R)-1,2-dihydroquinolin-4-yl-[(2S,4S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol.
| Compound Name | (R)-1,2-dihydroquinolin-4-yl-[(2S,4S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol |
|---|---|
| PubChem CID | 139814513 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | (R)-1,2-dihydroquinolin-4-yl-[(2S,4S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol |
| SMILES | C=C[C@@H]1CN2CC[C@H]1C[C@H]2[C@H](O)C1=CCNc2ccccc21 |
| InChI | InChI=1S/C19H24N2O/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17/h2-7,13-14,18-20,22H,1,8-12H2/t13-,14+,18+,19-/m1/s1 |
| InChIKey | XFCNBUKFNBMACA-SPLQCWDRSA-N |
| XLogP | 2.75 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|