C45H96O4Si3Sn — CID 139814881
tri(propan-2-yl)-[[(2R,3S,4R)-6-tributylstannyl-3,4-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-2-yl]methoxy]silane (PubChem CID 139814881) has the molecular formula C45H96O4Si3Sn and a molecular weight of 904.23 g/mol. Its IUPAC name is tri(propan-2-yl)-[[(2R,3S,4R)-6-tributylstannyl-3,4-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-2-yl]methoxy]silane.
| Compound Name | tri(propan-2-yl)-[[(2R,3S,4R)-6-tributylstannyl-3,4-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 139814881 |
| Molecular Formula | C45H96O4Si3Sn |
| Molecular Weight | 904.23 g/mol |
| Exact Mass | 904.56 |
| IUPAC Name | tri(propan-2-yl)-[[(2R,3S,4R)-6-tributylstannyl-3,4-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-2-yl]methoxy]silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C33H69O4Si3.3C4H9.Sn/c1-22(2)38(23(3)4,24(5)6)35-21-32-33(37-40(28(13)14,29(15)16)30(17)18)31(19-20-34-32)36-39(25(7)8,26(9)10)27(11)12;3*1-3-4-2;/h19,22-33H,21H2,1-18H3;3*1,3-4H2,2H3;/t31-,32-,33-;;;;/m1..../s1 |
| InChIKey | LHNFJAFPMRNQLR-VBJLDWKPSA-N |
| XLogP | 15.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.23 |
| LogP ≤ 5 | 15.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|