C36H76O3Si2Sn — CID 139814886
[(2S,3S,4S)-2-methyl-6-tributylstannyl-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane (PubChem CID 139814886) has the molecular formula C36H76O3Si2Sn and a molecular weight of 731.88 g/mol. Its IUPAC name is [(2S,3S,4S)-2-methyl-6-tributylstannyl-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(2S,3S,4S)-2-methyl-6-tributylstannyl-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 139814886 |
| Molecular Formula | C36H76O3Si2Sn |
| Molecular Weight | 731.88 g/mol |
| Exact Mass | 732.44 |
| IUPAC Name | [(2S,3S,4S)-2-methyl-6-tributylstannyl-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)O1 |
| InChI | InChI=1S/C24H49O3Si2.3C4H9.Sn/c1-16(2)28(17(3)4,18(5)6)26-23-14-15-25-22(13)24(23)27-29(19(7)8,20(9)10)21(11)12;3*1-3-4-2;/h14,16-24H,1-13H3;3*1,3-4H2,2H3;/t22-,23-,24-;;;;/m0..../s1 |
| InChIKey | RNLNPOIPYMKYDZ-OYBMIZIMSA-N |
| XLogP | 12.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.88 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|