C21H27NO6S — CID 139815169
[3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutyl] benzenesulfonate (PubChem CID 139815169) has the molecular formula C21H27NO6S and a molecular weight of 421.52 g/mol. Its IUPAC name is [3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutyl] benzenesulfonate.
| Compound Name | [3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutyl] benzenesulfonate |
|---|---|
| PubChem CID | 139815169 |
| Molecular Formula | C21H27NO6S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutyl] benzenesulfonate |
| SMILES | CC(C)(C)OC(=O)NC(c1ccccc1)C(O)CCOS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H27NO6S/c1-21(2,3)28-20(24)22-19(16-10-6-4-7-11-16)18(23)14-15-27-29(25,26)17-12-8-5-9-13-17/h4-13,18-19,23H,14-15H2,1-3H3,(H,22,24) |
| InChIKey | GYNKHSKGPDGGOI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|