About benzyl 2-hydroxydodecyl carbonate
benzyl 2-hydroxydodecyl carbonate (PubChem CID 139815173) has the molecular formula C20H32O4
and a molecular weight of 336.47 g/mol. Its IUPAC name is benzyl 2-hydroxydodecyl carbonate.
Molecular Properties
| Compound Name | benzyl 2-hydroxydodecyl carbonate |
| PubChem CID | 139815173 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | benzyl 2-hydroxydodecyl carbonate |
| SMILES | CCCCCCCCCCC(O)COC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-6-7-8-12-15-19(21)17-24-20(22)23-16-18-13-10-9-11-14-18/h9-11,13-14,19,21H,2-8,12,15-17H2,1H3 |
| InChIKey | UDQQDPDIEYIKNH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-hydroxydodecyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-hydroxydodecyl carbonate?
The IUPAC name of benzyl 2-hydroxydodecyl carbonate (CID 139815173) is benzyl 2-hydroxydodecyl carbonate.
What is the SMILES notation for benzyl 2-hydroxydodecyl carbonate?
The canonical SMILES for benzyl 2-hydroxydodecyl carbonate is CCCCCCCCCCC(O)COC(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-hydroxydodecyl carbonate?
The InChIKey is UDQQDPDIEYIKNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O4/c1-2-3-4-5-6-7-8-12-15-19(21)17-24-20(22)23-16-18-13-10-9-11-14-18/h9-11,13-14,19,21H,2-8,12,15-17H2,1H3.
What are the key properties of benzyl 2-hydroxydodecyl carbonate?
benzyl 2-hydroxydodecyl carbonate has a molecular weight of 336.47 g/mol, XLogP of 5.23, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-hydroxydodecyl carbonate is sourced from PubChem (CID 139815173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).