About 6-hydroxyhexyl benzenesulfonate
6-hydroxyhexyl benzenesulfonate (PubChem CID 139815295) has the molecular formula C12H18O4S
and a molecular weight of 258.34 g/mol. Its IUPAC name is 6-hydroxyhexyl benzenesulfonate.
Molecular Properties
| Compound Name | 6-hydroxyhexyl benzenesulfonate |
| PubChem CID | 139815295 |
| Molecular Formula | C12H18O4S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 6-hydroxyhexyl benzenesulfonate |
| SMILES | O=S(=O)(OCCCCCCO)c1ccccc1 |
| InChI | InChI=1S/C12H18O4S/c13-10-6-1-2-7-11-16-17(14,15)12-8-4-3-5-9-12/h3-5,8-9,13H,1-2,6-7,10-11H2 |
| InChIKey | PCLDJMZLFRQVMR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxyhexyl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxyhexyl benzenesulfonate?
The IUPAC name of 6-hydroxyhexyl benzenesulfonate (CID 139815295) is 6-hydroxyhexyl benzenesulfonate.
What is the SMILES notation for 6-hydroxyhexyl benzenesulfonate?
The canonical SMILES for 6-hydroxyhexyl benzenesulfonate is O=S(=O)(OCCCCCCO)c1ccccc1.
What is the InChIKey of 6-hydroxyhexyl benzenesulfonate?
The InChIKey is PCLDJMZLFRQVMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4S/c13-10-6-1-2-7-11-16-17(14,15)12-8-4-3-5-9-12/h3-5,8-9,13H,1-2,6-7,10-11H2.
What are the key properties of 6-hydroxyhexyl benzenesulfonate?
6-hydroxyhexyl benzenesulfonate has a molecular weight of 258.34 g/mol, XLogP of 1.94, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxyhexyl benzenesulfonate is sourced from PubChem (CID 139815295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).