About N-(4-hydroxy-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanesulfonamide
N-(4-hydroxy-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanesulfonamide (PubChem CID 139815678) has the molecular formula C10H13NO5S
and a molecular weight of 259.28 g/mol. Its IUPAC name is N-(4-hydroxy-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(4-hydroxy-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanesulfonamide |
| PubChem CID | 139815678 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | N-(4-hydroxy-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanesulfonamide |
| SMILES | COc1cc(O)c2c(c1)OCC2NS(C)(=O)=O |
| InChI | InChI=1S/C10H13NO5S/c1-15-6-3-8(12)10-7(11-17(2,13)14)5-16-9(10)4-6/h3-4,7,11-12H,5H2,1-2H3 |
| InChIKey | FEEZQOUGEPFJJF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze N-(4-hydroxy-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxy-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanesulfonamide?
The IUPAC name of N-(4-hydroxy-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanesulfonamide (CID 139815678) is N-(4-hydroxy-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanesulfonamide.
What is the SMILES notation for N-(4-hydroxy-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanesulfonamide?
The canonical SMILES for N-(4-hydroxy-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanesulfonamide is COc1cc(O)c2c(c1)OCC2NS(C)(=O)=O.
What is the InChIKey of N-(4-hydroxy-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanesulfonamide?
The InChIKey is FEEZQOUGEPFJJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO5S/c1-15-6-3-8(12)10-7(11-17(2,13)14)5-16-9(10)4-6/h3-4,7,11-12H,5H2,1-2H3.
What are the key properties of N-(4-hydroxy-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanesulfonamide?
N-(4-hydroxy-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanesulfonamide has a molecular weight of 259.28 g/mol, XLogP of 0.38, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxy-6-methoxy-2,3-dihydro-1-benzofuran-3-yl)methanesulfonamide is sourced from PubChem (CID 139815678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).