C6ClF13 — CID 139815772
2-chloro-1,1,1,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane (PubChem CID 139815772) has the molecular formula C6ClF13 and a molecular weight of 354.49 g/mol. Its IUPAC name is 2-chloro-1,1,1,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane.
| Compound Name | 2-chloro-1,1,1,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane |
|---|---|
| PubChem CID | 139815772 |
| Molecular Formula | C6ClF13 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | 2-chloro-1,1,1,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(Cl)C(F)(F)F |
| InChI | InChI=1S/C6ClF13/c7-1(8,5(15,16)17)2(9,10)3(11,12)4(13,14)6(18,19)20 |
| InChIKey | PSXQOUMJAOQVDA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|