About 1,3,4-trimethyl-2,4-dihydrotriazol-1-ium
1,3,4-trimethyl-2,4-dihydrotriazol-1-ium (PubChem CID 139815881) has the molecular formula C5H12N3+
and a molecular weight of 114.17 g/mol. Its IUPAC name is 1,3,4-trimethyl-2,4-dihydrotriazol-1-ium.
Molecular Properties
| Compound Name | 1,3,4-trimethyl-2,4-dihydrotriazol-1-ium |
| PubChem CID | 139815881 |
| Molecular Formula | C5H12N3+ |
| Molecular Weight | 114.17 g/mol |
| Exact Mass | 114.10 |
| IUPAC Name | 1,3,4-trimethyl-2,4-dihydrotriazol-1-ium |
| SMILES | CC1C=[N+](C)NN1C |
| InChI | InChI=1S/C5H12N3/c1-5-4-7(2)6-8(5)3/h4-6H,1-3H3/q+1 |
| InChIKey | QKDSZLBUPQQFLF-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.17 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3,4-trimethyl-2,4-dihydrotriazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,4-trimethyl-2,4-dihydrotriazol-1-ium?
The IUPAC name of 1,3,4-trimethyl-2,4-dihydrotriazol-1-ium (CID 139815881) is 1,3,4-trimethyl-2,4-dihydrotriazol-1-ium.
What is the SMILES notation for 1,3,4-trimethyl-2,4-dihydrotriazol-1-ium?
The canonical SMILES for 1,3,4-trimethyl-2,4-dihydrotriazol-1-ium is CC1C=[N+](C)NN1C.
What is the InChIKey of 1,3,4-trimethyl-2,4-dihydrotriazol-1-ium?
The InChIKey is QKDSZLBUPQQFLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N3/c1-5-4-7(2)6-8(5)3/h4-6H,1-3H3/q+1.
What are the key properties of 1,3,4-trimethyl-2,4-dihydrotriazol-1-ium?
1,3,4-trimethyl-2,4-dihydrotriazol-1-ium has a molecular weight of 114.17 g/mol, XLogP of -0.55, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,4-trimethyl-2,4-dihydrotriazol-1-ium is sourced from PubChem (CID 139815881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).