C12H8F14O — CID 139816536
3,3,4,4,5,5,5-heptafluoro-2-[(3,3,4,4,5,5,5-heptafluoro-2-methylidenepentoxy)methyl]pent-1-ene (PubChem CID 139816536) has the molecular formula C12H8F14O and a molecular weight of 434.17 g/mol. Its IUPAC name is 3,3,4,4,5,5,5-heptafluoro-2-[(3,3,4,4,5,5,5-heptafluoro-2-methylidenepentoxy)methyl]pent-1-ene.
| Compound Name | 3,3,4,4,5,5,5-heptafluoro-2-[(3,3,4,4,5,5,5-heptafluoro-2-methylidenepentoxy)methyl]pent-1-ene |
|---|---|
| PubChem CID | 139816536 |
| Molecular Formula | C12H8F14O |
| Molecular Weight | 434.17 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 3,3,4,4,5,5,5-heptafluoro-2-[(3,3,4,4,5,5,5-heptafluoro-2-methylidenepentoxy)methyl]pent-1-ene |
| SMILES | C=C(COCC(=C)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H8F14O/c1-5(7(13,14)9(17,18)11(21,22)23)3-27-4-6(2)8(15,16)10(19,20)12(24,25)26/h1-4H2 |
| InChIKey | WOTQWWRACIZKIC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.17 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|