C30H43N5O — CID 139816593
N-[1-[1-[3-(3,4-dimethylphenyl)pyrrolidin-2-yl]ethyl]piperidin-2-yl]-N-(2-ethoxyethyl)-1H-benzimidazol-2-amine (PubChem CID 139816593) has the molecular formula C30H43N5O and a molecular weight of 489.71 g/mol. Its IUPAC name is N-[1-[1-[3-(3,4-dimethylphenyl)pyrrolidin-2-yl]ethyl]piperidin-2-yl]-N-(2-ethoxyethyl)-1H-benzimidazol-2-amine.
| Compound Name | N-[1-[1-[3-(3,4-dimethylphenyl)pyrrolidin-2-yl]ethyl]piperidin-2-yl]-N-(2-ethoxyethyl)-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 139816593 |
| Molecular Formula | C30H43N5O |
| Molecular Weight | 489.71 g/mol |
| Exact Mass | 489.35 |
| IUPAC Name | N-[1-[1-[3-(3,4-dimethylphenyl)pyrrolidin-2-yl]ethyl]piperidin-2-yl]-N-(2-ethoxyethyl)-1H-benzimidazol-2-amine |
| SMILES | CCOCCN(c1nc2ccccc2[nH]1)C1CCCCN1C(C)C1NCCC1c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C30H43N5O/c1-5-36-19-18-35(30-32-26-10-6-7-11-27(26)33-30)28-12-8-9-17-34(28)23(4)29-25(15-16-31-29)24-14-13-21(2)22(3)20-24/h6-7,10-11,13-14,20,23,25,28-29,31H,5,8-9,12,15-19H2,1-4H3,(H,32,33) |
| InChIKey | VQKALVCBQDKFCT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 56.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.71 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|