C19H26N2O5 — CID 139816623
6-(2,4-dimethylphenoxy)-1-(1-methoxyethoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione (PubChem CID 139816623) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is 6-(2,4-dimethylphenoxy)-1-(1-methoxyethoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione.
| Compound Name | 6-(2,4-dimethylphenoxy)-1-(1-methoxyethoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139816623 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 6-(2,4-dimethylphenoxy)-1-(1-methoxyethoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione |
| SMILES | COC(C)OCn1c(Oc2ccc(C)cc2C)c(C(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H26N2O5/c1-11(2)16-17(22)20-19(23)21(10-25-14(5)24-6)18(16)26-15-8-7-12(3)9-13(15)4/h7-9,11,14H,10H2,1-6H3,(H,20,22,23) |
| InChIKey | BMONNCKILJOMFJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|