C27H32O2 — CID 139816985
2-methyl-5-[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]penta-2,4-dienoic acid (PubChem CID 139816985) has the molecular formula C27H32O2 and a molecular weight of 388.55 g/mol. Its IUPAC name is 2-methyl-5-[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]penta-2,4-dienoic acid.
| Compound Name | 2-methyl-5-[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 139816985 |
| Molecular Formula | C27H32O2 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 2-methyl-5-[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]penta-2,4-dienoic acid |
| SMILES | CC(=CC=Cc1cccc(-c2cc3c(cc2C)C(C)(C)CCC3(C)C)c1)C(=O)O |
| InChI | InChI=1S/C27H32O2/c1-18(25(28)29)9-7-10-20-11-8-12-21(16-20)22-17-24-23(15-19(22)2)26(3,4)13-14-27(24,5)6/h7-12,15-17H,13-14H2,1-6H3,(H,28,29) |
| InChIKey | ZDGYCYJMWODJRQ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|