C38H31FN2O4 — CID 139818690
methyl 1,3-dibenzhydryl-5-(2-fluorobenzoyl)-2-oxoimidazolidine-4-carboxylate (PubChem CID 139818690) has the molecular formula C38H31FN2O4 and a molecular weight of 598.67 g/mol. Its IUPAC name is methyl 1,3-dibenzhydryl-5-(2-fluorobenzoyl)-2-oxoimidazolidine-4-carboxylate.
| Compound Name | methyl 1,3-dibenzhydryl-5-(2-fluorobenzoyl)-2-oxoimidazolidine-4-carboxylate |
|---|---|
| PubChem CID | 139818690 |
| Molecular Formula | C38H31FN2O4 |
| Molecular Weight | 598.67 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | methyl 1,3-dibenzhydryl-5-(2-fluorobenzoyl)-2-oxoimidazolidine-4-carboxylate |
| SMILES | COC(=O)C1C(C(=O)c2ccccc2F)N(C(c2ccccc2)c2ccccc2)C(=O)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H31FN2O4/c1-45-37(43)35-34(36(42)30-24-14-15-25-31(30)39)40(32(26-16-6-2-7-17-26)27-18-8-3-9-19-27)38(44)41(35)33(28-20-10-4-11-21-28)29-22-12-5-13-23-29/h2-25,32-35H,1H3 |
| InChIKey | KSTBIKKXGMYUFF-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.67 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |