About dimethyl 1-benzhydryl-5-benzoyl-3-benzyl-2-oxoimidazolidine-4,4-dicarboxylate
dimethyl 1-benzhydryl-5-benzoyl-3-benzyl-2-oxoimidazolidine-4,4-dicarboxylate (PubChem CID 139818789) has the molecular formula C34H30N2O6
and a molecular weight of 562.62 g/mol. Its IUPAC name is dimethyl 1-benzhydryl-5-benzoyl-3-benzyl-2-oxoimidazolidine-4,4-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 1-benzhydryl-5-benzoyl-3-benzyl-2-oxoimidazolidine-4,4-dicarboxylate |
| PubChem CID | 139818789 |
| Molecular Formula | C34H30N2O6 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | dimethyl 1-benzhydryl-5-benzoyl-3-benzyl-2-oxoimidazolidine-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C(C(=O)c2ccccc2)N(C(c2ccccc2)c2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C34H30N2O6/c1-41-31(38)34(32(39)42-2)30(29(37)27-21-13-6-14-22-27)36(33(40)35(34)23-24-15-7-3-8-16-24)28(25-17-9-4-10-18-25)26-19-11-5-12-20-26/h3-22,28,30H,23H2,1-2H3 |
| InChIKey | LGIOWNOSMCANLN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 1-benzhydryl-5-benzoyl-3-benzyl-2-oxoimidazolidine-4,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 1-benzhydryl-5-benzoyl-3-benzyl-2-oxoimidazolidine-4,4-dicarboxylate?
The IUPAC name of dimethyl 1-benzhydryl-5-benzoyl-3-benzyl-2-oxoimidazolidine-4,4-dicarboxylate (CID 139818789) is dimethyl 1-benzhydryl-5-benzoyl-3-benzyl-2-oxoimidazolidine-4,4-dicarboxylate.
What is the SMILES notation for dimethyl 1-benzhydryl-5-benzoyl-3-benzyl-2-oxoimidazolidine-4,4-dicarboxylate?
The canonical SMILES for dimethyl 1-benzhydryl-5-benzoyl-3-benzyl-2-oxoimidazolidine-4,4-dicarboxylate is COC(=O)C1(C(=O)OC)C(C(=O)c2ccccc2)N(C(c2ccccc2)c2ccccc2)C(=O)N1Cc1ccccc1.
What is the InChIKey of dimethyl 1-benzhydryl-5-benzoyl-3-benzyl-2-oxoimidazolidine-4,4-dicarboxylate?
The InChIKey is LGIOWNOSMCANLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H30N2O6/c1-41-31(38)34(32(39)42-2)30(29(37)27-21-13-6-14-22-27)36(33(40)35(34)23-24-15-7-3-8-16-24)28(25-17-9-4-10-18-25)26-19-11-5-12-20-26/h3-22,28,30H,23H2,1-2H3.
What are the key properties of dimethyl 1-benzhydryl-5-benzoyl-3-benzyl-2-oxoimidazolidine-4,4-dicarboxylate?
dimethyl 1-benzhydryl-5-benzoyl-3-benzyl-2-oxoimidazolidine-4,4-dicarboxylate has a molecular weight of 562.62 g/mol, XLogP of 5.05, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1-benzhydryl-5-benzoyl-3-benzyl-2-oxoimidazolidine-4,4-dicarboxylate is sourced from PubChem (CID 139818789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).