About 3,4-diaminopiperazine-2,6-dione
3,4-diaminopiperazine-2,6-dione (PubChem CID 139819967) has the molecular formula C4H8N4O2
and a molecular weight of 144.13 g/mol. Its IUPAC name is 3,4-diaminopiperazine-2,6-dione.
Molecular Properties
| Compound Name | 3,4-diaminopiperazine-2,6-dione |
| PubChem CID | 139819967 |
| Molecular Formula | C4H8N4O2 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | 3,4-diaminopiperazine-2,6-dione |
| SMILES | NC1C(=O)NC(=O)CN1N |
| InChI | InChI=1S/C4H8N4O2/c5-3-4(10)7-2(9)1-8(3)6/h3H,1,5-6H2,(H,7,9,10) |
| InChIKey | LSYQNLMGWPQPET-UHFFFAOYSA-N |
| XLogP | -2.90 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diaminopiperazine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diaminopiperazine-2,6-dione?
The IUPAC name of 3,4-diaminopiperazine-2,6-dione (CID 139819967) is 3,4-diaminopiperazine-2,6-dione.
What is the SMILES notation for 3,4-diaminopiperazine-2,6-dione?
The canonical SMILES for 3,4-diaminopiperazine-2,6-dione is NC1C(=O)NC(=O)CN1N.
What is the InChIKey of 3,4-diaminopiperazine-2,6-dione?
The InChIKey is LSYQNLMGWPQPET-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4O2/c5-3-4(10)7-2(9)1-8(3)6/h3H,1,5-6H2,(H,7,9,10).
What are the key properties of 3,4-diaminopiperazine-2,6-dione?
3,4-diaminopiperazine-2,6-dione has a molecular weight of 144.13 g/mol, XLogP of -2.90, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diaminopiperazine-2,6-dione is sourced from PubChem (CID 139819967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).