C10H7F3N2O3 — CID 139819993
6-(hydroxymethyl)-7-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 139819993) has the molecular formula C10H7F3N2O3 and a molecular weight of 260.17 g/mol. Its IUPAC name is 6-(hydroxymethyl)-7-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-(hydroxymethyl)-7-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 139819993 |
| Molecular Formula | C10H7F3N2O3 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 6-(hydroxymethyl)-7-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc(CO)c(C(F)(F)F)cc2[nH]c1=O |
| InChI | InChI=1S/C10H7F3N2O3/c11-10(12,13)5-2-7-6(1-4(5)3-16)14-8(17)9(18)15-7/h1-2,16H,3H2,(H,14,17)(H,15,18) |
| InChIKey | WBZAWIGTSYTFRH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|