About 7-chloro-3-(1,4-oxathian-4-ium-4-yl)-2-oxo-1H-quinolin-4-olate
7-chloro-3-(1,4-oxathian-4-ium-4-yl)-2-oxo-1H-quinolin-4-olate (PubChem CID 139820581) has the molecular formula C13H12ClNO3S
and a molecular weight of 297.76 g/mol. Its IUPAC name is 7-chloro-3-(1,4-oxathian-4-ium-4-yl)-2-oxo-1H-quinolin-4-olate.
Molecular Properties
| Compound Name | 7-chloro-3-(1,4-oxathian-4-ium-4-yl)-2-oxo-1H-quinolin-4-olate |
| PubChem CID | 139820581 |
| Molecular Formula | C13H12ClNO3S |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 7-chloro-3-(1,4-oxathian-4-ium-4-yl)-2-oxo-1H-quinolin-4-olate |
| SMILES | O=c1[nH]c2cc(Cl)ccc2c([O-])c1[S+]1CCOCC1 |
| InChI | InChI=1S/C13H12ClNO3S/c14-8-1-2-9-10(7-8)15-13(17)12(11(9)16)19-5-3-18-4-6-19/h1-2,7H,3-6H2,(H-,15,16,17) |
| InChIKey | WQUFGKZKDGSLTL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 65.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-3-(1,4-oxathian-4-ium-4-yl)-2-oxo-1H-quinolin-4-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3-(1,4-oxathian-4-ium-4-yl)-2-oxo-1H-quinolin-4-olate?
The IUPAC name of 7-chloro-3-(1,4-oxathian-4-ium-4-yl)-2-oxo-1H-quinolin-4-olate (CID 139820581) is 7-chloro-3-(1,4-oxathian-4-ium-4-yl)-2-oxo-1H-quinolin-4-olate.
What is the SMILES notation for 7-chloro-3-(1,4-oxathian-4-ium-4-yl)-2-oxo-1H-quinolin-4-olate?
The canonical SMILES for 7-chloro-3-(1,4-oxathian-4-ium-4-yl)-2-oxo-1H-quinolin-4-olate is O=c1[nH]c2cc(Cl)ccc2c([O-])c1[S+]1CCOCC1.
What is the InChIKey of 7-chloro-3-(1,4-oxathian-4-ium-4-yl)-2-oxo-1H-quinolin-4-olate?
The InChIKey is WQUFGKZKDGSLTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClNO3S/c14-8-1-2-9-10(7-8)15-13(17)12(11(9)16)19-5-3-18-4-6-19/h1-2,7H,3-6H2,(H-,15,16,17).
What are the key properties of 7-chloro-3-(1,4-oxathian-4-ium-4-yl)-2-oxo-1H-quinolin-4-olate?
7-chloro-3-(1,4-oxathian-4-ium-4-yl)-2-oxo-1H-quinolin-4-olate has a molecular weight of 297.76 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3-(1,4-oxathian-4-ium-4-yl)-2-oxo-1H-quinolin-4-olate is sourced from PubChem (CID 139820581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).