C29H20Cl2F6N2O2 — CID 139821901
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(2,4-dichlorophenyl)-N-methyl-2-oxo-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene-3-carboxamide (PubChem CID 139821901) has the molecular formula C29H20Cl2F6N2O2 and a molecular weight of 613.39 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(2,4-dichlorophenyl)-N-methyl-2-oxo-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene-3-carboxamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(2,4-dichlorophenyl)-N-methyl-2-oxo-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 139821901 |
| Molecular Formula | C29H20Cl2F6N2O2 |
| Molecular Weight | 613.39 g/mol |
| Exact Mass | 612.08 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(2,4-dichlorophenyl)-N-methyl-2-oxo-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene-3-carboxamide |
| SMILES | CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)c1c(-c2ccc(Cl)cc2Cl)c2cccc3c2n(c1=O)CCC3 |
| InChI | InChI=1S/C29H20Cl2F6N2O2/c1-38(14-15-10-17(28(32,33)34)12-18(11-15)29(35,36)37)26(40)24-23(20-8-7-19(30)13-22(20)31)21-6-2-4-16-5-3-9-39(25(16)21)27(24)41/h2,4,6-8,10-13H,3,5,9,14H2,1H3 |
| InChIKey | WPKDCMRVMBOTKR-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.39 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |