C14H25N3O2 — CID 139822006
N-carbamoyl-2-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enamide (PubChem CID 139822006) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is N-carbamoyl-2-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enamide.
| Compound Name | N-carbamoyl-2-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 139822006 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | N-carbamoyl-2-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enamide |
| SMILES | C=C(C)C(=O)N(C(N)=O)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C14H25N3O2/c1-9(2)11(18)17(12(15)19)10-7-13(3,4)16-14(5,6)8-10/h10,16H,1,7-8H2,2-6H3,(H2,15,19) |
| InChIKey | HRTIYVVGVFCVSP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|