C23H33NO4 — CID 139822341
N-(6,6-dimethoxy-3-oxocyclohexa-1,4-dien-1-yl)-3,7,11-trimethyldodeca-2,6,10-trienamide (PubChem CID 139822341) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is N-(6,6-dimethoxy-3-oxocyclohexa-1,4-dien-1-yl)-3,7,11-trimethyldodeca-2,6,10-trienamide.
| Compound Name | N-(6,6-dimethoxy-3-oxocyclohexa-1,4-dien-1-yl)-3,7,11-trimethyldodeca-2,6,10-trienamide |
|---|---|
| PubChem CID | 139822341 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | N-(6,6-dimethoxy-3-oxocyclohexa-1,4-dien-1-yl)-3,7,11-trimethyldodeca-2,6,10-trienamide |
| SMILES | COC1(OC)C=CC(=O)C=C1NC(=O)C=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C23H33NO4/c1-17(2)9-7-10-18(3)11-8-12-19(4)15-22(26)24-21-16-20(25)13-14-23(21,27-5)28-6/h9,11,13-16H,7-8,10,12H2,1-6H3,(H,24,26) |
| InChIKey | YFOQVDXCTYDQPK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|