C2H2AlO8P — CID 139822733
(4,5-dioxo-1,3,2-dioxalumolan-2-yl) dihydrogen phosphate (PubChem CID 139822733) has the molecular formula C2H2AlO8P and a molecular weight of 211.99 g/mol. Its IUPAC name is (4,5-dioxo-1,3,2-dioxalumolan-2-yl) dihydrogen phosphate.
| Compound Name | (4,5-dioxo-1,3,2-dioxalumolan-2-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 139822733 |
| Molecular Formula | C2H2AlO8P |
| Molecular Weight | 211.99 g/mol |
| Exact Mass | 211.93 |
| IUPAC Name | (4,5-dioxo-1,3,2-dioxalumolan-2-yl) dihydrogen phosphate |
| SMILES | O=C1O[Al](OP(=O)(O)O)OC1=O |
| InChI | InChI=1S/C2H2O4.Al.H3O4P/c3-1(4)2(5)6;;1-5(2,3)4/h(H,3,4)(H,5,6);;(H3,1,2,3,4)/q;+3;/p-3 |
| InChIKey | UWNQPOLOMCYBQL-UHFFFAOYSA-K |
| XLogP | -1.82 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.99 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|