About tert-butyl (NZ)-N-[2,5-dihydropyrrol-1-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate
tert-butyl (NZ)-N-[2,5-dihydropyrrol-1-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate (PubChem CID 139822784) has the molecular formula C15H25N3O4
and a molecular weight of 311.38 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[2,5-dihydropyrrol-1-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate.
Molecular Properties
| Compound Name | tert-butyl (NZ)-N-[2,5-dihydropyrrol-1-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
| PubChem CID | 139822784 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | tert-butyl (NZ)-N-[2,5-dihydropyrrol-1-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)/N=C(/NC(=O)OC(C)(C)C)N1CC=CC1 |
| InChI | InChI=1S/C15H25N3O4/c1-14(2,3)21-12(19)16-11(18-9-7-8-10-18)17-13(20)22-15(4,5)6/h7-8H,9-10H2,1-6H3,(H,16,17,19,20) |
| InChIKey | SFXCSZWAFUIFFZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (NZ)-N-[2,5-dihydropyrrol-1-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (NZ)-N-[2,5-dihydropyrrol-1-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate?
The IUPAC name of tert-butyl (NZ)-N-[2,5-dihydropyrrol-1-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate (CID 139822784) is tert-butyl (NZ)-N-[2,5-dihydropyrrol-1-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate.
What is the SMILES notation for tert-butyl (NZ)-N-[2,5-dihydropyrrol-1-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate?
The canonical SMILES for tert-butyl (NZ)-N-[2,5-dihydropyrrol-1-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate is CC(C)(C)OC(=O)/N=C(/NC(=O)OC(C)(C)C)N1CC=CC1.
What is the InChIKey of tert-butyl (NZ)-N-[2,5-dihydropyrrol-1-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate?
The InChIKey is SFXCSZWAFUIFFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O4/c1-14(2,3)21-12(19)16-11(18-9-7-8-10-18)17-13(20)22-15(4,5)6/h7-8H,9-10H2,1-6H3,(H,16,17,19,20).
What are the key properties of tert-butyl (NZ)-N-[2,5-dihydropyrrol-1-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate?
tert-butyl (NZ)-N-[2,5-dihydropyrrol-1-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate has a molecular weight of 311.38 g/mol, XLogP of 2.67, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (NZ)-N-[2,5-dihydropyrrol-1-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate is sourced from PubChem (CID 139822784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).