C25H25N3O6 — CID 139823200
[(N-carboxyanilino)-(N-propoxycarbonylanilino)methyl]-phenylcarbamic acid (PubChem CID 139823200) has the molecular formula C25H25N3O6 and a molecular weight of 463.49 g/mol. Its IUPAC name is [(N-carboxyanilino)-(N-propoxycarbonylanilino)methyl]-phenylcarbamic acid.
| Compound Name | [(N-carboxyanilino)-(N-propoxycarbonylanilino)methyl]-phenylcarbamic acid |
|---|---|
| PubChem CID | 139823200 |
| Molecular Formula | C25H25N3O6 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | [(N-carboxyanilino)-(N-propoxycarbonylanilino)methyl]-phenylcarbamic acid |
| SMILES | CCCOC(=O)N(c1ccccc1)C(N(C(=O)O)c1ccccc1)N(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C25H25N3O6/c1-2-18-34-25(33)28(21-16-10-5-11-17-21)22(26(23(29)30)19-12-6-3-7-13-19)27(24(31)32)20-14-8-4-9-15-20/h3-17,22H,2,18H2,1H3,(H,29,30)(H,31,32) |
| InChIKey | FFNDDIJYKZZPMD-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|