C10H18O7 — CID 139823854
2,3-dihydroxypropanoyl 2-hydroxy-2-(hydroxymethyl)-4-methylpentanoate (PubChem CID 139823854) has the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. Its IUPAC name is 2,3-dihydroxypropanoyl 2-hydroxy-2-(hydroxymethyl)-4-methylpentanoate.
| Compound Name | 2,3-dihydroxypropanoyl 2-hydroxy-2-(hydroxymethyl)-4-methylpentanoate |
|---|---|
| PubChem CID | 139823854 |
| Molecular Formula | C10H18O7 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2,3-dihydroxypropanoyl 2-hydroxy-2-(hydroxymethyl)-4-methylpentanoate |
| SMILES | CC(C)CC(O)(CO)C(=O)OC(=O)C(O)CO |
| InChI | InChI=1S/C10H18O7/c1-6(2)3-10(16,5-12)9(15)17-8(14)7(13)4-11/h6-7,11-13,16H,3-5H2,1-2H3 |
| InChIKey | ZOXDWOMHMBOHBQ-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|