C17H12N2OS — CID 139824152
13-(4-methoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene (PubChem CID 139824152) has the molecular formula C17H12N2OS and a molecular weight of 292.36 g/mol. Its IUPAC name is 13-(4-methoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene.
| Compound Name | 13-(4-methoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
|---|---|
| PubChem CID | 139824152 |
| Molecular Formula | C17H12N2OS |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 13-(4-methoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
| SMILES | COc1ccc(-c2ccnc3sc4cnccc4c23)cc1 |
| InChI | InChI=1S/C17H12N2OS/c1-20-12-4-2-11(3-5-12)13-7-9-19-17-16(13)14-6-8-18-10-15(14)21-17/h2-10H,1H3 |
| InChIKey | XZALZJNPSINFFY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |