C27H38O2 — CID 139824515
2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cycloheptyl]phenol (PubChem CID 139824515) has the molecular formula C27H38O2 and a molecular weight of 394.60 g/mol. Its IUPAC name is 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cycloheptyl]phenol.
| Compound Name | 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cycloheptyl]phenol |
|---|---|
| PubChem CID | 139824515 |
| Molecular Formula | C27H38O2 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cycloheptyl]phenol |
| SMILES | CC(C)(C)c1cc(C2(c3ccc(O)c(C(C)(C)C)c3)CCCCCC2)ccc1O |
| InChI | InChI=1S/C27H38O2/c1-25(2,3)21-17-19(11-13-23(21)28)27(15-9-7-8-10-16-27)20-12-14-24(29)22(18-20)26(4,5)6/h11-14,17-18,28-29H,7-10,15-16H2,1-6H3 |
| InChIKey | FWSWHRCNEZYTMG-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |