C33H46O2 — CID 139824935
2-tert-butyl-4-[9-(3-tert-butyl-4-hydroxycyclohexyl)fluoren-9-yl]cyclohexan-1-ol (PubChem CID 139824935) has the molecular formula C33H46O2 and a molecular weight of 474.73 g/mol. Its IUPAC name is 2-tert-butyl-4-[9-(3-tert-butyl-4-hydroxycyclohexyl)fluoren-9-yl]cyclohexan-1-ol.
| Compound Name | 2-tert-butyl-4-[9-(3-tert-butyl-4-hydroxycyclohexyl)fluoren-9-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 139824935 |
| Molecular Formula | C33H46O2 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.35 |
| IUPAC Name | 2-tert-butyl-4-[9-(3-tert-butyl-4-hydroxycyclohexyl)fluoren-9-yl]cyclohexan-1-ol |
| SMILES | CC(C)(C)C1CC(C2(C3CCC(O)C(C(C)(C)C)C3)c3ccccc3-c3ccccc32)CCC1O |
| InChI | InChI=1S/C33H46O2/c1-31(2,3)27-19-21(15-17-29(27)34)33(22-16-18-30(35)28(20-22)32(4,5)6)25-13-9-7-11-23(25)24-12-8-10-14-26(24)33/h7-14,21-22,27-30,34-35H,15-20H2,1-6H3 |
| InChIKey | DQUCMJPOUAXHIS-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |