C32H35NO6 — CID 139825780
tert-butyl (3aR,6R,6aR)-2,2-dimethyl-4-oxo-6-(trityloxymethyl)-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 139825780) has the molecular formula C32H35NO6 and a molecular weight of 529.63 g/mol. Its IUPAC name is tert-butyl (3aR,6R,6aR)-2,2-dimethyl-4-oxo-6-(trityloxymethyl)-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aR,6R,6aR)-2,2-dimethyl-4-oxo-6-(trityloxymethyl)-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 139825780 |
| Molecular Formula | C32H35NO6 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | tert-butyl (3aR,6R,6aR)-2,2-dimethyl-4-oxo-6-(trityloxymethyl)-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@@H]2OC(C)(C)O[C@@H]2[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H35NO6/c1-30(2,3)39-29(35)33-25(26-27(28(33)34)38-31(4,5)37-26)21-36-32(22-15-9-6-10-16-22,23-17-11-7-12-18-23)24-19-13-8-14-20-24/h6-20,25-27H,21H2,1-5H3/t25-,26-,27-/m1/s1 |
| InChIKey | FMKJBZQFVPYDEP-ZONZVBGPSA-N |
| XLogP | 5.66 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|