C10H13N7O2S — CID 139826147
N'-(4,6-diamino-1,3,5-triazin-2-yl)-1-phenylmethanesulfonohydrazide (PubChem CID 139826147) has the molecular formula C10H13N7O2S and a molecular weight of 295.33 g/mol. Its IUPAC name is N'-(4,6-diamino-1,3,5-triazin-2-yl)-1-phenylmethanesulfonohydrazide.
| Compound Name | N'-(4,6-diamino-1,3,5-triazin-2-yl)-1-phenylmethanesulfonohydrazide |
|---|---|
| PubChem CID | 139826147 |
| Molecular Formula | C10H13N7O2S |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N'-(4,6-diamino-1,3,5-triazin-2-yl)-1-phenylmethanesulfonohydrazide |
| SMILES | Nc1nc(N)nc(NNS(=O)(=O)Cc2ccccc2)n1 |
| InChI | InChI=1S/C10H13N7O2S/c11-8-13-9(12)15-10(14-8)16-17-20(18,19)6-7-4-2-1-3-5-7/h1-5,17H,6H2,(H5,11,12,13,14,15,16) |
| InChIKey | CRAJYFQYHYARJO-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|