C12H20O4S2 — CID 139826252
methyl 2,6-bis(acetylsulfanyl)-3-methylhexanoate (PubChem CID 139826252) has the molecular formula C12H20O4S2 and a molecular weight of 292.42 g/mol. Its IUPAC name is methyl 2,6-bis(acetylsulfanyl)-3-methylhexanoate.
| Compound Name | methyl 2,6-bis(acetylsulfanyl)-3-methylhexanoate |
|---|---|
| PubChem CID | 139826252 |
| Molecular Formula | C12H20O4S2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | methyl 2,6-bis(acetylsulfanyl)-3-methylhexanoate |
| SMILES | COC(=O)C(SC(C)=O)C(C)CCCSC(C)=O |
| InChI | InChI=1S/C12H20O4S2/c1-8(6-5-7-17-9(2)13)11(12(15)16-4)18-10(3)14/h8,11H,5-7H2,1-4H3 |
| InChIKey | KAFGNFPMCGBROG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|